C31H34N4O — CID 44533823
(E)-N-[4-[2-(7-cyano-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-3-quinolin-3-ylprop-2-enamide (PubChem CID 44533823) has the molecular formula C31H34N4O and a molecular weight of 478.64 g/mol. Its IUPAC name is (E)-N-[4-[2-(7-cyano-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-3-quinolin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-[2-(7-cyano-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-3-quinolin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 44533823 |
| Molecular Formula | C31H34N4O |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | (E)-N-[4-[2-(7-cyano-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]-3-quinolin-3-ylprop-2-enamide |
| SMILES | N#Cc1ccc2c(c1)CCN(CCC1CCC(NC(=O)/C=C/c3cnc4ccccc4c3)CC1)CC2 |
| InChI | InChI=1S/C31H34N4O/c32-21-24-5-9-26-14-17-35(18-15-27(26)19-24)16-13-23-6-10-29(11-7-23)34-31(36)12-8-25-20-28-3-1-2-4-30(28)33-22-25/h1-5,8-9,12,19-20,22-23,29H,6-7,10-11,13-18H2,(H,34,36)/b12-8+ |
| InChIKey | QTBBOJSEKJMLOM-XYOKQWHBSA-N |
| XLogP | 5.29 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|