C29H32N4O — CID 10647305
(E)-N-[4-[2-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]cyclohexyl]-3-(1H-indol-3-yl)prop-2-enamide (PubChem CID 10647305) has the molecular formula C29H32N4O and a molecular weight of 452.60 g/mol. Its IUPAC name is (E)-N-[4-[2-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]cyclohexyl]-3-(1H-indol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]cyclohexyl]-3-(1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10647305 |
| Molecular Formula | C29H32N4O |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (E)-N-[4-[2-(7-cyano-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]cyclohexyl]-3-(1H-indol-3-yl)prop-2-enamide |
| SMILES | N#Cc1ccc2c(c1)CN(CCC1CCC(NC(=O)/C=C/c3c[nH]c4ccccc34)CC1)CC2 |
| InChI | InChI=1S/C29H32N4O/c30-18-22-5-8-23-14-16-33(20-25(23)17-22)15-13-21-6-10-26(11-7-21)32-29(34)12-9-24-19-31-28-4-2-1-3-27(24)28/h1-5,8-9,12,17,19,21,26,31H,6-7,10-11,13-16,20H2,(H,32,34)/b12-9+ |
| InChIKey | XLVZTPFZKIHPPD-FMIVXFBMSA-N |
| XLogP | 5.18 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|