C27H30ClF3N3O+ — CID 70555088
acetyl-diphenyl-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]azanium;hydrochloride (PubChem CID 70555088) has the molecular formula C27H30ClF3N3O+ and a molecular weight of 505.00 g/mol. Its IUPAC name is acetyl-diphenyl-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]azanium;hydrochloride.
| Compound Name | acetyl-diphenyl-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]azanium;hydrochloride |
|---|---|
| PubChem CID | 70555088 |
| Molecular Formula | C27H30ClF3N3O+ |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | acetyl-diphenyl-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]azanium;hydrochloride |
| SMILES | CC(=O)[N+](CCN1CCN(c2cccc(C(F)(F)F)c2)CC1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C27H29F3N3O.ClH/c1-22(34)33(25-11-4-2-5-12-25,26-13-6-3-7-14-26)20-19-31-15-17-32(18-16-31)24-10-8-9-23(21-24)27(28,29)30;/h2-14,21H,15-20H2,1H3;1H/q+1; |
| InChIKey | FXLLRGXDESIJHG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|