C21H22F3N3O — CID 10157148
1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-3H-indol-2-one (PubChem CID 10157148) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-3H-indol-2-one.
| Compound Name | 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 10157148 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-3H-indol-2-one |
| SMILES | O=C1Cc2ccccc2N1CCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H22F3N3O/c22-21(23,24)17-5-3-6-18(15-17)26-11-8-25(9-12-26)10-13-27-19-7-2-1-4-16(19)14-20(27)28/h1-7,15H,8-14H2 |
| InChIKey | XELDSRWKMDRNDV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |