C24H26F3N3O2 — CID 42631197
3-(2-methylphenyl)-1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 42631197) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-(2-methylphenyl)-1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(2-methylphenyl)-1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42631197 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-(2-methylphenyl)-1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccccc1C1CC(=O)N(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)C1=O |
| InChI | InChI=1S/C24H26F3N3O2/c1-17-5-2-3-8-20(17)21-16-22(31)30(23(21)32)14-11-28-9-12-29(13-10-28)19-7-4-6-18(15-19)24(25,26)27/h2-8,15,21H,9-14,16H2,1H3 |
| InChIKey | GPWBBTISZUBWAP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|