C23H26ClN3O2 — CID 42631196
1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3-(2-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 42631196) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3-(2-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3-(2-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42631196 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3-(2-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccccc1C1CC(=O)N(CCN2CCN(c3cccc(Cl)c3)CC2)C1=O |
| InChI | InChI=1S/C23H26ClN3O2/c1-17-5-2-3-8-20(17)21-16-22(28)27(23(21)29)14-11-25-9-12-26(13-10-25)19-7-4-6-18(24)15-19/h2-8,15,21H,9-14,16H2,1H3 |
| InChIKey | PCGHLRMNLLZPEX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|