C25H35ClN4O3 — CID 11442899
N-[(3S)-1-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide (PubChem CID 11442899) has the molecular formula C25H35ClN4O3 and a molecular weight of 475.03 g/mol. Its IUPAC name is N-[(3S)-1-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[(3S)-1-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 11442899 |
| Molecular Formula | C25H35ClN4O3 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | N-[(3S)-1-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(N[C@H]1CC(=O)N(CCCCN2CCN(c3cccc(Cl)c3)CC2)C1=O)C1CCCCC1 |
| InChI | InChI=1S/C25H35ClN4O3/c26-20-9-6-10-21(17-20)29-15-13-28(14-16-29)11-4-5-12-30-23(31)18-22(25(30)33)27-24(32)19-7-2-1-3-8-19/h6,9-10,17,19,22H,1-5,7-8,11-16,18H2,(H,27,32)/t22-/m0/s1 |
| InChIKey | JQGSUXZAAKIPPD-QFIPXVFZSA-N |
| XLogP | 3.07 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|