C26H30ClN3O2 — CID 14086477
4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 14086477) has the molecular formula C26H30ClN3O2 and a molecular weight of 452.00 g/mol. Its IUPAC name is 4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | 4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 14086477 |
| Molecular Formula | C26H30ClN3O2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 4-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C4C=CC43)C2C(=O)N1CCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C26H30ClN3O2/c27-17-4-3-5-18(16-17)29-14-12-28(13-15-29)10-1-2-11-30-25(31)23-21-8-9-22(24(23)26(30)32)20-7-6-19(20)21/h3-9,16,19-24H,1-2,10-15H2 |
| InChIKey | BAGRNOLJNGNKJI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|