C27H28ClN3O2 — CID 12965902
2-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 12965902) has the molecular formula C27H28ClN3O2 and a molecular weight of 461.99 g/mol. Its IUPAC name is 2-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 12965902 |
| Molecular Formula | C27H28ClN3O2 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C27H28ClN3O2/c28-21-9-6-10-22(19-21)30-17-15-29(16-18-30)13-2-1-3-14-31-26(32)23-11-4-7-20-8-5-12-24(25(20)23)27(31)33/h4-12,19H,1-3,13-18H2 |
| InChIKey | BRSWQJJEGMARJU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|