C33H30N4O2S — CID 123466795
2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 123466795) has the molecular formula C33H30N4O2S and a molecular weight of 546.70 g/mol. Its IUPAC name is 2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 123466795 |
| Molecular Formula | C33H30N4O2S |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCCCN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C33H30N4O2S/c38-32-25-12-7-9-23-10-8-13-26(30(23)25)33(39)37(32)18-6-5-17-35-19-21-36(22-20-35)31-24-11-1-3-15-28(24)40-29-16-4-2-14-27(29)34-31/h1-4,7-16H,5-6,17-22H2 |
| InChIKey | MLNPXYHLGQUQCL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|