C25H31N3O8S — CID 24748386
2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol;2,3-dihydroxybutanedioic acid (PubChem CID 24748386) has the molecular formula C25H31N3O8S and a molecular weight of 533.60 g/mol. Its IUPAC name is 2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol;2,3-dihydroxybutanedioic acid.
| Compound Name | 2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 24748386 |
| Molecular Formula | C25H31N3O8S |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.OCCOCCN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C21H25N3O2S.C4H6O6/c25-14-16-26-15-13-23-9-11-24(12-10-23)21-17-5-1-3-7-19(17)27-20-8-4-2-6-18(20)22-21;5-1(3(7)8)2(6)4(9)10/h1-8,25H,9-16H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | BQYYFZVMQUIQOU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 163.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|