C27H39N7O4S — CID 25176893
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol (PubChem CID 25176893) has the molecular formula C27H39N7O4S and a molecular weight of 557.72 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 25176893 |
| Molecular Formula | C27H39N7O4S |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.OCCOCCN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C21H25N3O2S.C6H14N4O2/c25-14-16-26-15-13-23-9-11-24(12-10-23)21-17-5-1-3-7-19(17)27-20-8-4-2-6-18(20)22-21;7-4(5(11)12)2-1-3-10-6(8)9/h1-8,25H,9-16H2;4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | YWINLRWDJAWKSM-VWMHFEHESA-N |
| XLogP | 1.31 |
| TPSA | 176.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|