C29H34N4O2S — CID 123386151
2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 123386151) has the molecular formula C29H34N4O2S and a molecular weight of 502.68 g/mol. Its IUPAC name is 2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 123386151 |
| Molecular Formula | C29H34N4O2S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 2-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCCCN1CCN(C3=Nc4ccccc4Sc4ccccc43)CC1)CCCC2 |
| InChI | InChI=1S/C29H34N4O2S/c34-28-21-9-1-2-10-22(21)29(35)33(28)16-8-7-15-31-17-19-32(20-18-31)27-23-11-3-5-13-25(23)36-26-14-6-4-12-24(26)30-27/h3-6,11-14,34-35H,1-2,7-10,15-20H2 |
| InChIKey | FDPLHTQEWBWTHB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|