C28H34N4O2S — CID 71151783
1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,4-dimethylpiperidine-2,6-dione (PubChem CID 71151783) has the molecular formula C28H34N4O2S and a molecular weight of 490.67 g/mol. Its IUPAC name is 1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 71151783 |
| Molecular Formula | C28H34N4O2S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(CCCCN2CCN(C3=Nc4ccccc4Sc4ccccc43)CC2)C(=O)C1 |
| InChI | InChI=1S/C28H34N4O2S/c1-28(2)19-25(33)32(26(34)20-28)14-8-7-13-30-15-17-31(18-16-30)27-21-9-3-5-11-23(21)35-24-12-6-4-10-22(24)29-27/h3-6,9-12H,7-8,13-20H2,1-2H3 |
| InChIKey | MNJTWICXOXPUAP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|