C19H19N3OS — CID 44546073
1-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanone (PubChem CID 44546073) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanone.
| Compound Name | 1-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 44546073 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanone |
| SMILES | CC(=O)N1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C19H19N3OS/c1-14(23)21-10-12-22(13-11-21)19-15-6-2-4-8-17(15)24-18-9-5-3-7-16(18)20-19/h2-9H,10-13H2,1H3 |
| InChIKey | HXDQJFMZTKIQQN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |