C26H30N4O2S — CID 71151705
1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 71151705) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71151705 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 1-[4-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)butyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CCCCN2CCN(C3=Nc4ccccc4Sc4ccccc43)CC2)C1=O |
| InChI | InChI=1S/C26H30N4O2S/c1-19-18-24(31)30(26(19)32)13-7-6-12-28-14-16-29(17-15-28)25-20-8-2-4-10-22(20)33-23-11-5-3-9-21(23)27-25/h2-5,8-11,19H,6-7,12-18H2,1H3 |
| InChIKey | ASHOBENFFQHSRW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|