C38H43BrN6O2S2 — CID 159057395
2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol;2-bromoethanol;6-piperazin-1-ylbenzo[b][1,4]benzothiazepine (PubChem CID 159057395) has the molecular formula C38H43BrN6O2S2 and a molecular weight of 759.84 g/mol. Its IUPAC name is 2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol;2-bromoethanol;6-piperazin-1-ylbenzo[b][1,4]benzothiazepine.
| Compound Name | 2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol;2-bromoethanol;6-piperazin-1-ylbenzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 159057395 |
| Molecular Formula | C38H43BrN6O2S2 |
| Molecular Weight | 759.84 g/mol |
| Exact Mass | 758.21 |
| IUPAC Name | 2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol;2-bromoethanol;6-piperazin-1-ylbenzo[b][1,4]benzothiazepine |
| SMILES | OCCBr.OCCN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1.c1ccc2c(c1)N=C(N1CCNCC1)c1ccccc1S2 |
| InChI | InChI=1S/C19H21N3OS.C17H17N3S.C2H5BrO/c23-14-13-21-9-11-22(12-10-21)19-15-5-1-3-7-17(15)24-18-8-4-2-6-16(18)20-19;1-3-7-15-13(5-1)17(20-11-9-18-10-12-20)19-14-6-2-4-8-16(14)21-15;3-1-2-4/h1-8,23H,9-14H2;1-8,18H,9-12H2;4H,1-2H2 |
| InChIKey | JYAIMMURMBCPTB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.84 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|