About [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol
[6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol (PubChem CID 10717286) has the molecular formula C23H27N3O3S
and a molecular weight of 425.55 g/mol. Its IUPAC name is [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol.
Molecular Properties
| Compound Name | [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol |
| PubChem CID | 10717286 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol |
| SMILES | OCC1COCC(CN2CCN(C3=Nc4ccccc4Sc4ccccc43)CC2)O1 |
| InChI | InChI=1S/C23H27N3O3S/c27-14-18-16-28-15-17(29-18)13-25-9-11-26(12-10-25)23-19-5-1-3-7-21(19)30-22-8-4-2-6-20(22)24-23/h1-8,17-18,27H,9-16H2 |
| InChIKey | FISAHGXZGIYRLA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol?
The IUPAC name of [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol (CID 10717286) is [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol.
What is the SMILES notation for [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol?
The canonical SMILES for [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol is OCC1COCC(CN2CCN(C3=Nc4ccccc4Sc4ccccc43)CC2)O1.
What is the InChIKey of [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol?
The InChIKey is FISAHGXZGIYRLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O3S/c27-14-18-16-28-15-17(29-18)13-25-9-11-26(12-10-25)23-19-5-1-3-7-21(19)30-22-8-4-2-6-20(22)24-23/h1-8,17-18,27H,9-16H2.
What are the key properties of [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol?
[6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol has a molecular weight of 425.55 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)methyl]-1,4-dioxan-2-yl]methanol is sourced from PubChem (CID 10717286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).