C22H27N3O2S — CID 10596975
6-[4-(2,3-dimethoxypropyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine (PubChem CID 10596975) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 6-[4-(2,3-dimethoxypropyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine.
| Compound Name | 6-[4-(2,3-dimethoxypropyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 10596975 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 6-[4-(2,3-dimethoxypropyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
| SMILES | COCC(CN1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1)OC |
| InChI | InChI=1S/C22H27N3O2S/c1-26-16-17(27-2)15-24-11-13-25(14-12-24)22-18-7-3-5-9-20(18)28-21-10-6-4-8-19(21)23-22/h3-10,17H,11-16H2,1-2H3 |
| InChIKey | LHZUERDCLPXCOX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |