C18H19N3S — CID 16105
Dibenzo(b,f)(1,4)thiazepine, 11-(4-methyl-1-piperazinyl)- (PubChem CID 16105) has the molecular formula C18H19N3S and a molecular weight of 309.40 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine.
| Compound Name | Dibenzo(b,f)(1,4)thiazepine, 11-(4-methyl-1-piperazinyl)- |
|---|---|
| PubChem CID | 16105 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3SC4=CC=CC=C42 |
| InChI | InChI=1S/C18H19N3S/c1-20-10-12-21(13-11-20)18-14-6-2-4-8-16(14)22-17-9-5-3-7-15(17)19-18/h2-9H,10-13H2,1H3 |
| InChIKey | SFMINLHQDVFHIR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | 417 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |