C19H21N3OS — CID 10807021
2-[4-(Dibenzo[b,f][1,4]thiazepin-11-yl)piperazin-1-yl] ethanol (PubChem CID 10807021) has the molecular formula C19H21N3OS and a molecular weight of 339.50 g/mol. Its IUPAC name is 2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol.
| Compound Name | 2-[4-(Dibenzo[b,f][1,4]thiazepin-11-yl)piperazin-1-yl] ethanol |
|---|---|
| PubChem CID | 10807021 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol |
| SMILES | C1CN(CCN1CCO)C2=NC3=CC=CC=C3SC4=CC=CC=C42 |
| InChI | InChI=1S/C19H21N3OS/c23-14-13-21-9-11-22(12-10-21)19-15-5-1-3-7-17(15)24-18-8-4-2-6-16(18)20-19/h1-8,23H,9-14H2 |
| InChIKey | OFLMIXVKBNAUIB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 450 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |