C23H29N3O2S — CID 11795909
6-[4-(3,4-Dimethoxybutyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine (PubChem CID 11795909) has the molecular formula C23H29N3O2S and a molecular weight of 411.60 g/mol. Its IUPAC name is 6-[4-(3,4-dimethoxybutyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine.
| Compound Name | 6-[4-(3,4-Dimethoxybutyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 11795909 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 6-[4-(3,4-dimethoxybutyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
| SMILES | COCC(CCN1CCN(CC1)C2=NC3=CC=CC=C3SC4=CC=CC=C42)OC |
| InChI | InChI=1S/C23H29N3O2S/c1-27-17-18(28-2)11-12-25-13-15-26(16-14-25)23-19-7-3-5-9-21(19)29-22-10-6-4-8-20(22)24-23/h3-10,18H,11-17H2,1-2H3 |
| InChIKey | BJVUMFJTYVBRMZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | 538 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |