C18H18FN3S — CID 58015268
8-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine (PubChem CID 58015268) has the molecular formula C18H18FN3S and a molecular weight of 327.43 g/mol. Its IUPAC name is 8-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine.
| Compound Name | 8-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 58015268 |
| Molecular Formula | C18H18FN3S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 8-fluoro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
| SMILES | CN1CCN(C2=Nc3ccccc3Sc3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C18H18FN3S/c1-21-8-10-22(11-9-21)18-14-12-13(19)6-7-16(14)23-17-5-3-2-4-15(17)20-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | GSYXWIMVZURMCS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |