C17H16FN3S — CID 44537860
8-fluoro-6-piperazin-1-ylbenzo[b][1,4]benzothiazepine (PubChem CID 44537860) has the molecular formula C17H16FN3S and a molecular weight of 313.40 g/mol. Its IUPAC name is 8-fluoro-6-piperazin-1-ylbenzo[b][1,4]benzothiazepine.
| Compound Name | 8-fluoro-6-piperazin-1-ylbenzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 44537860 |
| Molecular Formula | C17H16FN3S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 8-fluoro-6-piperazin-1-ylbenzo[b][1,4]benzothiazepine |
| SMILES | Fc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1S2 |
| InChI | InChI=1S/C17H16FN3S/c18-12-5-6-15-13(11-12)17(21-9-7-19-8-10-21)20-14-3-1-2-4-16(14)22-15/h1-6,11,19H,7-10H2 |
| InChIKey | CXKQSMUCGLKJEI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |