C22H25N3OS — CID 10619728
6-[4-(oxolan-2-ylmethyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine (PubChem CID 10619728) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 6-[4-(oxolan-2-ylmethyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine.
| Compound Name | 6-[4-(oxolan-2-ylmethyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
|---|---|
| PubChem CID | 10619728 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 6-[4-(oxolan-2-ylmethyl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
| SMILES | c1ccc2c(c1)N=C(N1CCN(CC3CCCO3)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C22H25N3OS/c1-3-9-20-18(7-1)22(23-19-8-2-4-10-21(19)27-20)25-13-11-24(12-14-25)16-17-6-5-15-26-17/h1-4,7-10,17H,5-6,11-16H2 |
| InChIKey | BWMIMNUXQCHAAF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |