C23H30N4O2S — CID 130282232
2-[2-[4-[9-(methylaminomethyl)benzo[b][1,4]benzothiazepin-6-yl]piperazin-1-yl]ethoxy]ethanol (PubChem CID 130282232) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is 2-[2-[4-[9-(methylaminomethyl)benzo[b][1,4]benzothiazepin-6-yl]piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[9-(methylaminomethyl)benzo[b][1,4]benzothiazepin-6-yl]piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 130282232 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[2-[4-[9-(methylaminomethyl)benzo[b][1,4]benzothiazepin-6-yl]piperazin-1-yl]ethoxy]ethanol |
| SMILES | CNCc1ccc2c(c1)Sc1ccccc1N=C2N1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C23H30N4O2S/c1-24-17-18-6-7-19-22(16-18)30-21-5-3-2-4-20(21)25-23(19)27-10-8-26(9-11-27)12-14-29-15-13-28/h2-7,16,24,28H,8-15,17H2,1H3 |
| InChIKey | YJYUHKVVSYFXGQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|