C25H31N3O3 — CID 164621183
2-[6-[4-(3-methoxyphenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione (PubChem CID 164621183) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[6-[4-(3-methoxyphenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[4-(3-methoxyphenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164621183 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[6-[4-(3-methoxyphenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione |
| SMILES | COc1cccc(N2CCN(CCCCCCN3C(=O)c4ccccc4C3=O)CC2)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-31-21-10-8-9-20(19-21)27-17-15-26(16-18-27)13-6-2-3-7-14-28-24(29)22-11-4-5-12-23(22)25(28)30/h4-5,8-12,19H,2-3,6-7,13-18H2,1H3 |
| InChIKey | ZCCOYAFKWXCDAP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|