C25H30N2O4 — CID 67551931
2-[4-[4-(2,4-dimethoxyphenyl)piperidin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 67551931) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[4-[4-(2,4-dimethoxyphenyl)piperidin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(2,4-dimethoxyphenyl)piperidin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67551931 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[4-[4-(2,4-dimethoxyphenyl)piperidin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | COc1ccc(C2CCN(CCCCN3C(=O)c4ccccc4C3=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-30-19-9-10-20(23(17-19)31-2)18-11-15-26(16-12-18)13-5-6-14-27-24(28)21-7-3-4-8-22(21)25(27)29/h3-4,7-10,17-18H,5-6,11-16H2,1-2H3 |
| InChIKey | IVJLGOPBHGCWKZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|