C24H26N2O5 — CID 29364468
2-[4-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 29364468) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[4-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 29364468 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[4-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2C(=O)CCCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-30-16-11-12-21(31-2)19(15-16)20-9-5-13-25(20)22(27)10-6-14-26-23(28)17-7-3-4-8-18(17)24(26)29/h3-4,7-8,11-12,15,20H,5-6,9-10,13-14H2,1-2H3/t20-/m0/s1 |
| InChIKey | JJFPHBFAPUVKBP-FQEVSTJZSA-N |
| XLogP | 3.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|