C20H26N4O3 — CID 42961032
1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 42961032) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 42961032 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | COc1ccc(OC)c(C2CCCN2C(=O)CCCNc2ncccn2)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-26-15-8-9-18(27-2)16(14-15)17-6-4-13-24(17)19(25)7-3-10-21-20-22-11-5-12-23-20/h5,8-9,11-12,14,17H,3-4,6-7,10,13H2,1-2H3,(H,21,22,23) |
| InChIKey | ARQJXYJDEXBFEJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|