C20H22INO4 — CID 55388722
1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-(4-iodophenoxy)ethanone (PubChem CID 55388722) has the molecular formula C20H22INO4 and a molecular weight of 467.30 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-(4-iodophenoxy)ethanone.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-(4-iodophenoxy)ethanone |
|---|---|
| PubChem CID | 55388722 |
| Molecular Formula | C20H22INO4 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-(4-iodophenoxy)ethanone |
| SMILES | COc1ccc(OC)c(C2CCCN2C(=O)COc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C20H22INO4/c1-24-16-9-10-19(25-2)17(12-16)18-4-3-11-22(18)20(23)13-26-15-7-5-14(21)6-8-15/h5-10,12,18H,3-4,11,13H2,1-2H3 |
| InChIKey | LTMQCCAVMXCXPJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|