C22H25N2O4+ — CID 8834917
2-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 8834917) has the molecular formula C22H25N2O4+ and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8834917 |
| Molecular Formula | C22H25N2O4+ |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | COc1ccc([C@@H]2CCC[NH+]2CCN2C(=O)c3ccccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-27-15-9-10-18(20(14-15)28-2)19-8-5-11-23(19)12-13-24-21(25)16-6-3-4-7-17(16)22(24)26/h3-4,6-7,9-10,14,19H,5,8,11-13H2,1-2H3/p+1/t19-/m0/s1 |
| InChIKey | XIISXSOWMFMPRU-IBGZPJMESA-O |
| XLogP | 1.72 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|