C21H23N2O4+ — CID 9285221
2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]isoindole-1,3-dione (PubChem CID 9285221) has the molecular formula C21H23N2O4+ and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9285221 |
| Molecular Formula | C21H23N2O4+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]isoindole-1,3-dione |
| SMILES | COc1ccc(OC)c([C@H]2CCC[NH+]2CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-26-14-9-10-19(27-2)17(12-14)18-8-5-11-22(18)13-23-20(24)15-6-3-4-7-16(15)21(23)25/h3-4,6-7,9-10,12,18H,5,8,11,13H2,1-2H3/p+1/t18-/m1/s1 |
| InChIKey | YOOHXIIPHBIGCL-GOSISDBHSA-O |
| XLogP | 1.68 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|