C21H30N3O4+ — CID 9285285
3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9285285) has the molecular formula C21H30N3O4+ and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9285285 |
| Molecular Formula | C21H30N3O4+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 3-[[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(OC)c([C@H]2CCC[NH+]2CN2C(=O)NC3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C21H29N3O4/c1-27-15-8-9-18(28-2)16(13-15)17-7-6-12-23(17)14-24-19(25)21(22-20(24)26)10-4-3-5-11-21/h8-9,13,17H,3-7,10-12,14H2,1-2H3,(H,22,26)/p+1/t17-/m1/s1 |
| InChIKey | ICAXFPJYILSSPM-QGZVFWFLSA-O |
| XLogP | 1.64 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|