C22H32N3O3+ — CID 9460325
3-[[(2R)-2-(4-methoxyphenyl)azepan-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9460325) has the molecular formula C22H32N3O3+ and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-[[(2R)-2-(4-methoxyphenyl)azepan-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[(2R)-2-(4-methoxyphenyl)azepan-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9460325 |
| Molecular Formula | C22H32N3O3+ |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 3-[[(2R)-2-(4-methoxyphenyl)azepan-1-ium-1-yl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc([C@H]2CCCCC[NH+]2CN2C(=O)NC3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-28-18-11-9-17(10-12-18)19-8-4-2-7-15-24(19)16-25-20(26)22(23-21(25)27)13-5-3-6-14-22/h9-12,19H,2-8,13-16H2,1H3,(H,23,27)/p+1/t19-/m1/s1 |
| InChIKey | QBJWZVKDMFOPFJ-LJQANCHMSA-O |
| XLogP | 2.41 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|