C22H29N4O2S+ — CID 9330364
3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9330364) has the molecular formula C22H29N4O2S+ and a molecular weight of 413.57 g/mol. Its IUPAC name is 3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9330364 |
| Molecular Formula | C22H29N4O2S+ |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(C[NH+]1CCCC[C@@H]1c1nc3ccccc3s1)C2=O |
| InChI | InChI=1S/C22H28N4O2S/c1-15-9-11-22(12-10-15)20(27)26(21(28)24-22)14-25-13-5-4-7-17(25)19-23-16-6-2-3-8-18(16)29-19/h2-3,6,8,15,17H,4-5,7,9-14H2,1H3,(H,24,28)/p+1/t15?,17-,22?/m1/s1 |
| InChIKey | AQWSCVWFIQJANT-WIVVBHTDSA-O |
| XLogP | 2.86 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|