C17H19N4O3S+ — CID 9330710
1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-3-methylimidazolidine-2,4,5-trione (PubChem CID 9330710) has the molecular formula C17H19N4O3S+ and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-3-methylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-3-methylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9330710 |
| Molecular Formula | C17H19N4O3S+ |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-3-methylimidazolidine-2,4,5-trione |
| SMILES | CN1C(=O)C(=O)N(C[NH+]2CCCC[C@@H]2c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C17H18N4O3S/c1-19-15(22)16(23)21(17(19)24)10-20-9-5-4-7-12(20)14-18-11-6-2-3-8-13(11)25-14/h2-3,6,8,12H,4-5,7,9-10H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | ONMBEOPXWGZUQF-GFCCVEGCSA-O |
| XLogP | 0.78 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|