C19H20N3O2S+ — CID 9134855
2-[(2S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-2-yl]-1,3-benzothiazole (PubChem CID 9134855) has the molecular formula C19H20N3O2S+ and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(2S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[(2S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 9134855 |
| Molecular Formula | C19H20N3O2S+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[(2S)-1-[(4-nitrophenyl)methyl]piperidin-1-ium-2-yl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(C[NH+]2CCCC[C@H]2c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c23-22(24)15-10-8-14(9-11-15)13-21-12-4-3-6-17(21)19-20-16-5-1-2-7-18(16)25-19/h1-2,5,7-11,17H,3-4,6,12-13H2/p+1/t17-/m0/s1 |
| InChIKey | VJZVAAGGDCXCAA-KRWDZBQOSA-O |
| XLogP | 3.51 |
| TPSA | 60.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|