C23H23N2O3S+ — CID 9135553
4-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one (PubChem CID 9135553) has the molecular formula C23H23N2O3S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is 4-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 9135553 |
| Molecular Formula | C23H23N2O3S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(C[NH+]3CCCC[C@@H]3c3nc4ccccc4s3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H22N2O3S/c1-27-16-9-10-17-15(12-22(26)28-20(17)13-16)14-25-11-5-4-7-19(25)23-24-18-6-2-3-8-21(18)29-23/h2-3,6,8-10,12-13,19H,4-5,7,11,14H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | UJUCXIGHDAQEMP-LJQANCHMSA-O |
| XLogP | 3.72 |
| TPSA | 56.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|