C23H26NO3+ — CID 1398579
4-[(4-benzylpiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one (PubChem CID 1398579) has the molecular formula C23H26NO3+ and a molecular weight of 364.47 g/mol. Its IUPAC name is 4-[(4-benzylpiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(4-benzylpiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 1398579 |
| Molecular Formula | C23H26NO3+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-[(4-benzylpiperidin-1-ium-1-yl)methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(C[NH+]3CCC(Cc4ccccc4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H25NO3/c1-26-20-7-8-21-19(14-23(25)27-22(21)15-20)16-24-11-9-18(10-12-24)13-17-5-3-2-4-6-17/h2-8,14-15,18H,9-13,16H2,1H3/p+1 |
| InChIKey | HHMVMCYVZLGGPX-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|