C22H21N2O3S+ — CID 9032414
4-[[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one (PubChem CID 9032414) has the molecular formula C22H21N2O3S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-[[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 9032414 |
| Molecular Formula | C22H21N2O3S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(C[NH+]3CCC[C@@H]3c3nc4ccccc4s3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H20N2O3S/c1-26-15-8-9-16-14(11-21(25)27-19(16)12-15)13-24-10-4-6-18(24)22-23-17-5-2-3-7-20(17)28-22/h2-3,5,7-9,11-12,18H,4,6,10,13H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | YLIDHMZRCGRSLA-GOSISDBHSA-O |
| XLogP | 3.33 |
| TPSA | 56.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|