C20H21N4O4S+ — CID 9033883
2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 9033883) has the molecular formula C20H21N4O4S+ and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9033883 |
| Molecular Formula | C20H21N4O4S+ |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[NH+]2CCC[C@@H]2c2nc3ccccc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N4O4S/c1-28-13-8-9-14(17(11-13)24(26)27)21-19(25)12-23-10-4-6-16(23)20-22-15-5-2-3-7-18(15)29-20/h2-3,5,7-9,11,16H,4,6,10,12H2,1H3,(H,21,25)/p+1/t16-/m1/s1 |
| InChIKey | CNVATFYCIKHEMA-MRXNPFEDSA-O |
| XLogP | 2.57 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|