C20H23ClN3O5+ — CID 8853813
N-(4-chloro-2-nitrophenyl)-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide (PubChem CID 8853813) has the molecular formula C20H23ClN3O5+ and a molecular weight of 420.87 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8853813 |
| Molecular Formula | C20H23ClN3O5+ |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc([C@H]2CCC[NH+]2CC(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C20H22ClN3O5/c1-28-14-6-7-15(19(11-14)29-2)17-4-3-9-23(17)12-20(25)22-16-8-5-13(21)10-18(16)24(26)27/h5-8,10-11,17H,3-4,9,12H2,1-2H3,(H,22,25)/p+1/t17-/m1/s1 |
| InChIKey | JMEMHMYBRPCPJY-QGZVFWFLSA-O |
| XLogP | 2.62 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|