C21H26N3O5+ — CID 8832856
2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 8832856) has the molecular formula C21H26N3O5+ and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 8832856 |
| Molecular Formula | C21H26N3O5+ |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | COc1ccc(OC)c([C@@H]2CCC[NH+]2CC(=O)Nc2ccc([N+](=O)[O-])cc2C)c1 |
| InChI | InChI=1S/C21H25N3O5/c1-14-11-15(24(26)27)6-8-18(14)22-21(25)13-23-10-4-5-19(23)17-12-16(28-2)7-9-20(17)29-3/h6-9,11-12,19H,4-5,10,13H2,1-3H3,(H,22,25)/p+1/t19-/m0/s1 |
| InChIKey | RCMAPDZLDDKABD-IBGZPJMESA-O |
| XLogP | 2.28 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|