C21H26N3O4+ — CID 8835136
4-[[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetyl]amino]benzamide (PubChem CID 8835136) has the molecular formula C21H26N3O4+ and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-[[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8835136 |
| Molecular Formula | C21H26N3O4+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 4-[[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]acetyl]amino]benzamide |
| SMILES | COc1ccc([C@@H]2CCC[NH+]2CC(=O)Nc2ccc(C(N)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-16-9-10-17(19(12-16)28-2)18-4-3-11-24(18)13-20(25)23-15-7-5-14(6-8-15)21(22)26/h5-10,12,18H,3-4,11,13H2,1-2H3,(H2,22,26)(H,23,25)/p+1/t18-/m0/s1 |
| InChIKey | FFXCQAUSEKJYHC-SFHVURJKSA-O |
| XLogP | 1.16 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |