C17H23N2O3+ — CID 8856752
2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-prop-2-ynylacetamide (PubChem CID 8856752) has the molecular formula C17H23N2O3+ and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 8856752 |
| Molecular Formula | C17H23N2O3+ |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)C[NH+]1CCC[C@@H]1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C17H22N2O3/c1-4-9-18-17(20)12-19-10-5-6-15(19)14-8-7-13(21-2)11-16(14)22-3/h1,7-8,11,15H,5-6,9-10,12H2,2-3H3,(H,18,20)/p+1/t15-/m1/s1 |
| InChIKey | VMGRVQJMMHMRES-OAHLLOKOSA-O |
| XLogP | 0.17 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|