C24H33N2O5+ — CID 8857291
2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide (PubChem CID 8857291) has the molecular formula C24H33N2O5+ and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 8857291 |
| Molecular Formula | C24H33N2O5+ |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-ium-1-yl]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
| SMILES | CCOc1ccc(OCCNC(=O)C[NH+]2CCC[C@@H]2c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H32N2O5/c1-4-30-18-7-9-19(10-8-18)31-15-13-25-24(27)17-26-14-5-6-22(26)21-12-11-20(28-2)16-23(21)29-3/h7-12,16,22H,4-6,13-15,17H2,1-3H3,(H,25,27)/p+1/t22-/m1/s1 |
| InChIKey | NUGMHXQWVSQHQC-JOCHJYFZSA-O |
| XLogP | 2.02 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|