C18H26N3O4+ — CID 11931197
2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 11931197) has the molecular formula C18H26N3O4+ and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 11931197 |
| Molecular Formula | C18H26N3O4+ |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[NH+]2CCC[C@@H]3CCCC[C@@H]32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H25N3O4/c1-25-14-8-9-15(17(11-14)21(23)24)19-18(22)12-20-10-4-6-13-5-2-3-7-16(13)20/h8-9,11,13,16H,2-7,10,12H2,1H3,(H,19,22)/p+1/t13-,16-/m0/s1 |
| InChIKey | MYWXLZRLDVHHSV-BBRMVZONSA-O |
| XLogP | 1.78 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|