C20H22N3O6+ — CID 8758759
methyl (3R)-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate (PubChem CID 8758759) has the molecular formula C20H22N3O6+ and a molecular weight of 400.41 g/mol. Its IUPAC name is methyl (3R)-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate.
| Compound Name | methyl (3R)-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 8758759 |
| Molecular Formula | C20H22N3O6+ |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl (3R)-2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-1,2,3,4-tetrahydroisoquinolin-2-ium-3-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2ccccc2C[NH+]1CC(=O)Nc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N3O6/c1-28-15-7-8-16(17(10-15)23(26)27)21-19(24)12-22-11-14-6-4-3-5-13(14)9-18(22)20(25)29-2/h3-8,10,18H,9,11-12H2,1-2H3,(H,21,24)/p+1/t18-/m1/s1 |
| InChIKey | XTAQZZITFGGLJT-GOSISDBHSA-O |
| XLogP | 0.72 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|