C19H28N3O3+ — CID 11931483
2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide (PubChem CID 11931483) has the molecular formula C19H28N3O3+ and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide.
| Compound Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 11931483 |
| Molecular Formula | C19H28N3O3+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)C[NH+]2CCC[C@H]3CCCC[C@@H]32)c1C |
| InChI | InChI=1S/C19H27N3O3/c1-13-9-10-17(22(24)25)19(14(13)2)20-18(23)12-21-11-5-7-15-6-3-4-8-16(15)21/h9-10,15-16H,3-8,11-12H2,1-2H3,(H,20,23)/p+1/t15-,16+/m1/s1 |
| InChIKey | UDHFDXGRRGOHFP-CVEARBPZSA-O |
| XLogP | 2.39 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|